(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide
Modify Date: 2026-08-06 11:04:08
(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide structure
|
Common Name | (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2229501-33-9 | Molecular Weight | 223.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H10ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H10ClN3O2S |
|---|---|
| Molecular Weight | 223.68 |
| InChIKey | NUAMFPHLGKAHSJ-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)c(Cl)c1CS(N)(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide? |
| A: CAS number of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide is 2229501-33-9. |
| Q: What is the molecular weight of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide? |
| A: Molecular weight of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide is 223.68. |
| Q: What is the molecular formula of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide? |
| A: Molecular formula of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide is C6H10ClN3O2S. |
| Q: What is the SMILES notation of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide? |
| A: SMILES notation of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide is Cc1nn(C)c(Cl)c1CS(N)(=O)=O. |
| Q: What is the English name of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide? |
| A: The English name of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide is (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide. |
| Q: What is the Chinese name of 2229501-33-9? |
| A: Chinese name of 2229501-33-9 is 2229501-33-9. |
| Q: What is the InChIKey of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide? |
| A: InChIKey of (5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methanesulfonamide is NUAMFPHLGKAHSJ-UHFFFAOYSA-N. |