5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine
Modify Date: 2026-07-20 14:05:16
5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine structure
|
Common Name | 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2229512-68-7 | Molecular Weight | 208.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9ClN2O |
|---|---|
| Molecular Weight | 208.64 |
| InChIKey | NKUJBLCQKXOTDQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1-c1cnc(N)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine? |
| A: InChIKey of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine is NKUJBLCQKXOTDQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine? |
| A: Molecular weight of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine is 208.64. |
| Q: What is the CAS number of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine? |
| A: CAS number of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine is 2229512-68-7. |
| Q: What is the SMILES notation of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine? |
| A: SMILES notation of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine is Cc1cc(Cl)ccc1-c1cnc(N)o1. |
| Q: What is the English name of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine? |
| A: The English name of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine is 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine. |
| Q: What is the molecular formula of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine? |
| A: Molecular formula of 5-(4-Chloro-2-methylphenyl)-1,3-oxazol-2-amine is C10H9ClN2O. |
| Q: What is the Chinese name of 2229512-68-7? |
| A: Chinese name of 2229512-68-7 is 2229512-68-7. |