Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate
Modify Date: 2026-07-04 12:03:18
Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate structure
|
Common Name | Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 2229517-82-0 | Molecular Weight | 221.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO2 |
|---|---|
| Molecular Weight | 221.29 |
| InChIKey | UPIBDPWDTSZZGT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CC(C)(C)CN)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate? |
| A: SMILES notation of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate is COC(=O)c1ccc(CC(C)(C)CN)cc1. |
| Q: What is the Chinese name of 2229517-82-0? |
| A: Chinese name of 2229517-82-0 is 2229517-82-0. |
| Q: What is the English name of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate? |
| A: The English name of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate is Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate. |
| Q: What is the InChIKey of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate? |
| A: InChIKey of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate is UPIBDPWDTSZZGT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate? |
| A: Molecular formula of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate is C13H19NO2. |
| Q: What is the molecular weight of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate? |
| A: Molecular weight of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate is 221.29. |
| Q: What is the CAS number of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate? |
| A: CAS number of Methyl 4-(3-amino-2,2-dimethylpropyl)benzoate is 2229517-82-0. |