2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine
Modify Date: 2026-08-02 07:22:28
2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine structure
|
Common Name | 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2229522-14-7 | Molecular Weight | 241.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8ClF4N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8ClF4N |
|---|---|
| Molecular Weight | 241.61 |
| InChIKey | FFTKCPVKUWTFLR-UHFFFAOYSA-N |
| SMILES | NCC(c1c(F)ccc(Cl)c1F)C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine? |
| A: SMILES notation of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine is NCC(c1c(F)ccc(Cl)c1F)C(F)F. |
| Q: What is the InChIKey of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine? |
| A: InChIKey of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine is FFTKCPVKUWTFLR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2229522-14-7? |
| A: Chinese name of 2229522-14-7 is 2229522-14-7. |
| Q: What is the CAS number of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine? |
| A: CAS number of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine is 2229522-14-7. |
| Q: What is the English name of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine? |
| A: The English name of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine is 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine. |
| Q: What is the molecular formula of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine? |
| A: Molecular formula of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine is C9H8ClF4N. |
| Q: What is the molecular weight of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine? |
| A: Molecular weight of 2-(3-Chloro-2,6-difluorophenyl)-3,3-difluoropropan-1-amine is 241.61. |