O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine
Modify Date: 2025-09-28 20:16:04
![O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine Structure](https://www.chemsrc.com/extcaspic/206/2229555-40-0.png)
O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine structure
|
Common Name | O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 2229555-40-0 | Molecular Weight | 180.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16N2O |
|---|---|
| Molecular Weight | 180.25 |
| InChIKey | UMHWANNVESFUAO-UHFFFAOYSA-N |
| SMILES | CC(ON)c1cc2c([nH]1)CCCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine? |
| A: Molecular formula of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine is C10H16N2O. |
| Q: What is the InChIKey of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine? |
| A: InChIKey of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine is UMHWANNVESFUAO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine? |
| A: SMILES notation of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine is CC(ON)c1cc2c([nH]1)CCCC2. |
| Q: What is the CAS number of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine? |
| A: CAS number of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine is 2229555-40-0. |
| Q: What is the Chinese name of 2229555-40-0? |
| A: Chinese name of 2229555-40-0 is 2229555-40-0. |
| Q: What is the molecular weight of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine? |
| A: Molecular weight of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine is 180.25. |
| Q: What is the English name of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine? |
| A: The English name of O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine is O-[1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethyl]hydroxylamine. |