methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate
Modify Date: 2025-11-06 06:50:38
![methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate Structure](https://www.chemsrc.com/extcaspic/261/2229558-77-2.png)
methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate structure
|
Common Name | methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate | ||
|---|---|---|---|---|
| CAS Number | 2229558-77-2 | Molecular Weight | 226.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N4O3 |
|---|---|
| Molecular Weight | 226.23 |
| InChIKey | SQHLXWVUMYKQOC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)C1(CCn2cnnn2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate? |
| A: Molecular formula of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate is C9H14N4O3. |
| Q: What is the SMILES notation of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate? |
| A: SMILES notation of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate is COC(=O)C(O)C1(CCn2cnnn2)CC1. |
| Q: What is the CAS number of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate? |
| A: CAS number of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate is 2229558-77-2. |
| Q: What is the Chinese name of 2229558-77-2? |
| A: Chinese name of 2229558-77-2 is 2229558-77-2. |
| Q: What is the molecular weight of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate? |
| A: Molecular weight of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate is 226.23. |
| Q: What is the InChIKey of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate? |
| A: InChIKey of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate is SQHLXWVUMYKQOC-UHFFFAOYSA-N. |
| Q: What is the English name of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate? |
| A: The English name of methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate is methyl 2-hydroxy-2-{1-[2-(1H-1,2,3,4-tetrazol-1-yl)ethyl]cyclopropyl}acetate. |