2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride
Modify Date: 2026-07-10 07:20:40
2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride structure
|
Common Name | 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2229559-00-4 | Molecular Weight | 262.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11FO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11FO5S |
|---|---|
| Molecular Weight | 262.26 |
| InChIKey | NXRKMSXIJKKJOC-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1CCS(=O)(=O)F)OCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229559-00-4? |
| A: Chinese name of 2229559-00-4 is 2229559-00-4. |
| Q: What is the English name of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride? |
| A: The English name of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride is 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride. |
| Q: What is the molecular formula of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride? |
| A: Molecular formula of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride is C10H11FO5S. |
| Q: What is the molecular weight of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride? |
| A: Molecular weight of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride is 262.26. |
| Q: What is the SMILES notation of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride? |
| A: SMILES notation of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride is COc1cc2c(cc1CCS(=O)(=O)F)OCO2. |
| Q: What is the CAS number of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride? |
| A: CAS number of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride is 2229559-00-4. |
| Q: What is the InChIKey of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride? |
| A: InChIKey of 2-(6-Methoxy-1,3-dioxaindan-5-yl)ethane-1-sulfonyl fluoride is NXRKMSXIJKKJOC-UHFFFAOYSA-N. |