2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid
Modify Date: 2026-08-27 17:51:28
![2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid Structure](https://www.chemsrc.com/extcaspic/226/2229561-59-3.png)
2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid structure
|
Common Name | 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2229561-59-3 | Molecular Weight | 222.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10N4O3 |
|---|---|
| Molecular Weight | 222.20 |
| InChIKey | NQECOSSHUIJPFW-UHFFFAOYSA-N |
| SMILES | CC(O)(Cc1cnc2n[nH]nc2c1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229561-59-3? |
| A: Chinese name of 2229561-59-3 is 2229561-59-3. |
| Q: What is the molecular formula of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid? |
| A: Molecular formula of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid is C9H10N4O3. |
| Q: What is the English name of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid? |
| A: The English name of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid is 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid. |
| Q: What is the CAS number of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid? |
| A: CAS number of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid is 2229561-59-3. |
| Q: What is the InChIKey of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid? |
| A: InChIKey of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid is NQECOSSHUIJPFW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid? |
| A: Molecular weight of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid is 222.20. |
| Q: What is the SMILES notation of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid? |
| A: SMILES notation of 2-hydroxy-2-methyl-3-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}propanoic acid is CC(O)(Cc1cnc2n[nH]nc2c1)C(=O)O. |