3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine
Modify Date: 2025-09-17 18:25:05
![3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine Structure](https://www.chemsrc.com/extcaspic/219/2229561-86-6.png)
3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine structure
|
Common Name | 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 2229561-86-6 | Molecular Weight | 228.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N4O |
|---|---|
| Molecular Weight | 228.25 |
| InChIKey | RVWMDGIOQLFCRQ-UHFFFAOYSA-N |
| SMILES | Nc1cc(CCc2nc3ccccc3[nH]2)no1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine? |
| A: InChIKey of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine is RVWMDGIOQLFCRQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine? |
| A: SMILES notation of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine is Nc1cc(CCc2nc3ccccc3[nH]2)no1. |
| Q: What is the molecular weight of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine? |
| A: Molecular weight of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine is 228.25. |
| Q: What is the English name of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine? |
| A: The English name of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine is 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine. |
| Q: What is the Chinese name of 2229561-86-6? |
| A: Chinese name of 2229561-86-6 is 2229561-86-6. |
| Q: What is the CAS number of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine? |
| A: CAS number of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine is 2229561-86-6. |
| Q: What is the molecular formula of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine? |
| A: Molecular formula of 3-[2-(1H-1,3-benzodiazol-2-yl)ethyl]-1,2-oxazol-5-amine is C12H12N4O. |