Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate
Modify Date: 2025-09-17 18:59:54
Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate structure
|
Common Name | Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2229563-18-0 | Molecular Weight | 227.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17NO4 |
|---|---|
| Molecular Weight | 227.26 |
| InChIKey | LGUPZVGGDKQBMM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(C)(CN)CO)oc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate? |
| A: The English name of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate is Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate. |
| Q: What is the CAS number of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate? |
| A: CAS number of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate is 2229563-18-0. |
| Q: What is the molecular formula of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate? |
| A: Molecular formula of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate is C11H17NO4. |
| Q: What is the molecular weight of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate? |
| A: Molecular weight of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate is 227.26. |
| Q: What is the Chinese name of 2229563-18-0? |
| A: Chinese name of 2229563-18-0 is 2229563-18-0. |
| Q: What is the InChIKey of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate? |
| A: InChIKey of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate is LGUPZVGGDKQBMM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate? |
| A: SMILES notation of Methyl 5-(1-amino-3-hydroxy-2-methylpropan-2-yl)-2-methylfuran-3-carboxylate is COC(=O)c1cc(C(C)(CN)CO)oc1C. |