O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine
Modify Date: 2025-09-17 12:37:03
![O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine Structure](https://www.chemsrc.com/extcaspic/459/2229575-97-5.png)
O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine structure
|
Common Name | O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 2229575-97-5 | Molecular Weight | 219.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28 |
| InChIKey | FRODVWWTOGFCAN-UHFFFAOYSA-N |
| SMILES | NOCC1(Cc2ccc3c(c2)CCO3)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine? |
| A: CAS number of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine is 2229575-97-5. |
| Q: What is the English name of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine? |
| A: The English name of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine is O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine. |
| Q: What is the InChIKey of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine? |
| A: InChIKey of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine is FRODVWWTOGFCAN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine? |
| A: Molecular weight of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine is 219.28. |
| Q: What is the molecular formula of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine? |
| A: Molecular formula of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine is C13H17NO2. |
| Q: What is the Chinese name of 2229575-97-5? |
| A: Chinese name of 2229575-97-5 is 2229575-97-5. |
| Q: What is the SMILES notation of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine? |
| A: SMILES notation of O-({1-[(2,3-dihydro-1-benzofuran-5-yl)methyl]cyclopropyl}methyl)hydroxylamine is NOCC1(Cc2ccc3c(c2)CCO3)CC1. |