[2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine
Modify Date: 2025-11-10 21:52:27
![[2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine Structure](https://www.chemsrc.com/extcaspic/217/2229576-50-3.png)
[2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine structure
|
Common Name | [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2229576-50-3 | Molecular Weight | 220.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O2 |
|---|---|
| Molecular Weight | 220.27 |
| InChIKey | UJVVYYZBYAXDAC-UHFFFAOYSA-N |
| SMILES | CC1(C)CC1(CN)c1ccccc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine? |
| A: SMILES notation of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine is CC1(C)CC1(CN)c1ccccc1[N+](=O)[O-]. |
| Q: What is the InChIKey of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine? |
| A: InChIKey of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine is UJVVYYZBYAXDAC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine? |
| A: Molecular weight of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine is 220.27. |
| Q: What is the Chinese name of 2229576-50-3? |
| A: Chinese name of 2229576-50-3 is 2229576-50-3. |
| Q: What is the CAS number of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine? |
| A: CAS number of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine is 2229576-50-3. |
| Q: What is the molecular formula of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine? |
| A: Molecular formula of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine is C12H16N2O2. |
| Q: What is the English name of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine? |
| A: The English name of [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine is [2,2-Dimethyl-1-(2-nitrophenyl)cyclopropyl]methanamine. |