(2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol
Modify Date: 2026-06-30 16:31:02
![(2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol Structure](https://www.chemsrc.com/extcaspic/179/2229579-72-8.png)
(2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol structure
|
Common Name | (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 2229579-72-8 | Molecular Weight | 276.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15F3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15F3OS |
|---|---|
| Molecular Weight | 276.32 |
| InChIKey | ZQFQGGJTJPOGHL-UHFFFAOYSA-N |
| SMILES | CC1(C)CC1(CO)c1ccc(SC(F)(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol? |
| A: CAS number of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol is 2229579-72-8. |
| Q: What is the English name of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol? |
| A: The English name of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol is (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol. |
| Q: What is the InChIKey of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol? |
| A: InChIKey of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol is ZQFQGGJTJPOGHL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol? |
| A: SMILES notation of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol is CC1(C)CC1(CO)c1ccc(SC(F)(F)F)cc1. |
| Q: What is the Chinese name of 2229579-72-8? |
| A: Chinese name of 2229579-72-8 is 2229579-72-8. |
| Q: What is the molecular formula of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol? |
| A: Molecular formula of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol is C13H15F3OS. |
| Q: What is the molecular weight of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol? |
| A: Molecular weight of (2,2-Dimethyl-1-{4-[(trifluoromethyl)sulfanyl]phenyl}cyclopropyl)methanol is 276.32. |