3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione
Modify Date: 2025-08-26 18:23:57
![3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione Structure](https://www.chemsrc.com/extcaspic/179/2229605-61-0.png)
3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione structure
|
Common Name | 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 2229605-61-0 | Molecular Weight | 220.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.26 |
| InChIKey | UPOFJDSBUMAQQI-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CC=C(C3CC(=O)OC3=O)C1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione? |
| A: SMILES notation of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione is CC1(C)C2CC=C(C3CC(=O)OC3=O)C1C2. |
| Q: What is the InChIKey of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione? |
| A: InChIKey of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione is UPOFJDSBUMAQQI-UHFFFAOYSA-N. |
| Q: What is the English name of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione? |
| A: The English name of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione is 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione. |
| Q: What is the CAS number of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione? |
| A: CAS number of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione is 2229605-61-0. |
| Q: What is the molecular formula of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione? |
| A: Molecular formula of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione is C13H16O3. |
| Q: What is the Chinese name of 2229605-61-0? |
| A: Chinese name of 2229605-61-0 is 2229605-61-0. |
| Q: What is the molecular weight of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione? |
| A: Molecular weight of 3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}oxolane-2,5-dione is 220.26. |