Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate
Modify Date: 2025-11-06 19:11:20
![Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate Structure](https://www.chemsrc.com/extcaspic/369/2229626-03-1.png)
Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate structure
|
Common Name | Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate | ||
|---|---|---|---|---|
| CAS Number | 2229626-03-1 | Molecular Weight | 219.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28 |
| InChIKey | JYZAGMUOVVTVQM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CC2(CN)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate? |
| A: InChIKey of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate is JYZAGMUOVVTVQM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2229626-03-1? |
| A: Chinese name of 2229626-03-1 is 2229626-03-1. |
| Q: What is the English name of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate? |
| A: The English name of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate is Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate. |
| Q: What is the molecular weight of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate? |
| A: Molecular weight of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate is 219.28. |
| Q: What is the molecular formula of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate? |
| A: Molecular formula of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate is C13H17NO2. |
| Q: What is the SMILES notation of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate? |
| A: SMILES notation of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate is COC(=O)c1ccc(CC2(CN)CC2)cc1. |
| Q: What is the CAS number of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate? |
| A: CAS number of Methyl 4-{[1-(aminomethyl)cyclopropyl]methyl}benzoate is 2229626-03-1. |