1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one
Modify Date: 2025-08-29 17:30:53
![1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one Structure](https://www.chemsrc.com/extcaspic/340/2229636-62-6.png)
1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one structure
|
Common Name | 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2229636-62-6 | Molecular Weight | 226.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12F2O2 |
|---|---|
| Molecular Weight | 226.22 |
| InChIKey | IPSIIDCMDFKZLW-UHFFFAOYSA-N |
| SMILES | COc1c(C2(C(C)=O)CC2)ccc(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one? |
| A: CAS number of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one is 2229636-62-6. |
| Q: What is the molecular formula of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one? |
| A: Molecular formula of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one is C12H12F2O2. |
| Q: What is the Chinese name of 2229636-62-6? |
| A: Chinese name of 2229636-62-6 is 2229636-62-6. |
| Q: What is the SMILES notation of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one? |
| A: SMILES notation of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one is COc1c(C2(C(C)=O)CC2)ccc(F)c1F. |
| Q: What is the English name of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one? |
| A: The English name of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one is 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one. |
| Q: What is the InChIKey of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one? |
| A: InChIKey of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one is IPSIIDCMDFKZLW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one? |
| A: Molecular weight of 1-[1-(3,4-Difluoro-2-methoxyphenyl)cyclopropyl]ethan-1-one is 226.22. |