1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene
Modify Date: 2026-08-06 10:00:31
1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene structure
|
Common Name | 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 2229648-14-8 | Molecular Weight | 215.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7F2NO3 |
|---|---|
| Molecular Weight | 215.15 |
| InChIKey | BKFRVUFWKZZKGV-SNAWJCMRSA-N |
| SMILES | COc1c(C=C[N+](=O)[O-])ccc(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene? |
| A: InChIKey of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene is BKFRVUFWKZZKGV-SNAWJCMRSA-N. |
| Q: What is the SMILES notation of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene? |
| A: SMILES notation of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene is COc1c(C=C[N+](=O)[O-])ccc(F)c1F. |
| Q: What is the English name of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene? |
| A: The English name of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene is 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene. |
| Q: What is the CAS number of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene? |
| A: CAS number of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene is 2229648-14-8. |
| Q: What is the molecular weight of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene? |
| A: Molecular weight of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene is 215.15. |
| Q: What is the molecular formula of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene? |
| A: Molecular formula of 1,2-Difluoro-3-methoxy-4-(2-nitroethenyl)benzene is C9H7F2NO3. |
| Q: What is the Chinese name of 2229648-14-8? |
| A: Chinese name of 2229648-14-8 is 2229648-14-8. |