4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine
Modify Date: 2026-07-07 15:19:47
4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine structure
|
Common Name | 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2229689-08-9 | Molecular Weight | 213.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13F2NO |
|---|---|
| Molecular Weight | 213.22 |
| InChIKey | YSUOHPVITAKKGA-ONEGZZNKSA-N |
| SMILES | COc1c(F)cc(F)cc1C=CC(C)N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine? |
| A: CAS number of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine is 2229689-08-9. |
| Q: What is the English name of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine? |
| A: The English name of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine is 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine. |
| Q: What is the Chinese name of 2229689-08-9? |
| A: Chinese name of 2229689-08-9 is 2229689-08-9. |
| Q: What is the molecular weight of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine? |
| A: Molecular weight of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine is 213.22. |
| Q: What is the InChIKey of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine? |
| A: InChIKey of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine is YSUOHPVITAKKGA-ONEGZZNKSA-N. |
| Q: What is the molecular formula of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine? |
| A: Molecular formula of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine is C11H13F2NO. |
| Q: What is the SMILES notation of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine? |
| A: SMILES notation of 4-(3,5-Difluoro-2-methoxyphenyl)but-3-en-2-amine is COc1c(F)cc(F)cc1C=CC(C)N. |