2-Chloro-N-ethyl-N-naphthalen-1-yl-acetamide structure
|
Common Name | 2-Chloro-N-ethyl-N-naphthalen-1-yl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 22302-57-4 | Molecular Weight | 247.72000 | |
| Density | 1.219g/cm3 | Boiling Point | 381.4ºC at 760 mmHg | |
| Molecular Formula | C14H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5ºC | |
| Name | 2-chloro-N-ethyl-N-naphthalen-1-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 381.4ºC at 760 mmHg |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72000 |
| Flash Point | 184.5ºC |
| Exact Mass | 247.07600 |
| PSA | 20.31000 |
| LogP | 3.43150 |
| Vapour Pressure | 5.07E-06mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | SAFDDWRCNKTNRS-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)CCl)c1cccc2ccccc12 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-N-ethyl-N-naphthylacetamide |