(6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one
Modify Date: 2026-07-06 08:51:12
![(6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one Structure](https://www.chemsrc.com/extcaspic/172/2230522-04-8.png)
(6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one structure
|
Common Name | (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one | ||
|---|---|---|---|---|
| CAS Number | 2230522-04-8 | Molecular Weight | 194.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N4O |
|---|---|
| Molecular Weight | 194.23 |
| InChIKey | PUGILTRGMHILQW-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(N)CCc2nn(C)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one? |
| A: SMILES notation of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one is CN1C(=O)C(N)CCc2nn(C)cc21. |
| Q: What is the English name of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one? |
| A: The English name of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one is (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one. |
| Q: What is the InChIKey of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one? |
| A: InChIKey of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one is PUGILTRGMHILQW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one? |
| A: Molecular weight of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one is 194.23. |
| Q: What is the molecular formula of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one? |
| A: Molecular formula of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one is C9H14N4O. |
| Q: What is the CAS number of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one? |
| A: CAS number of (6R)-6-amino-2,4-dimethyl-7,8-dihydro-6H-pyrazolo[4,3-b]azepin-5-one is 2230522-04-8. |
| Q: What is the Chinese name of 2230522-04-8? |
| A: Chinese name of 2230522-04-8 is 2230522-04-8. |