1-Propionyl-eth-lad
Modify Date: 2026-08-03 15:38:20
1-Propionyl-eth-lad structure
|
Common Name | 1-Propionyl-eth-lad | ||
|---|---|---|---|---|
| CAS Number | 2230715-45-2 | Molecular Weight | 393.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H31N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Propionyl-eth-lad |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H31N3O2 |
|---|---|
| Molecular Weight | 393.5 |
| InChIKey | MLOFCBXSOAYCIF-DYESRHJHSA-N |
| SMILES | CCC(=O)n1cc2c3c(cccc31)C1=CC(C(=O)N(CC)CC)CN(CC)C1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-Propionyl-eth-lad? |
| A: SMILES notation of 1-Propionyl-eth-lad is CCC(=O)n1cc2c3c(cccc31)C1=CC(C(=O)N(CC)CC)CN(CC)C1C2. |
| Q: What is the Chinese name of 2230715-45-2? |
| A: Chinese name of 2230715-45-2 is 2230715-45-2. |
| Q: What is the molecular formula of 1-Propionyl-eth-lad? |
| A: Molecular formula of 1-Propionyl-eth-lad is C24H31N3O2. |
| Q: What is the English name of 1-Propionyl-eth-lad? |
| A: The English name of 1-Propionyl-eth-lad is 1-Propionyl-eth-lad. |
| Q: What is the InChIKey of 1-Propionyl-eth-lad? |
| A: InChIKey of 1-Propionyl-eth-lad is MLOFCBXSOAYCIF-DYESRHJHSA-N. |
| Q: What is the molecular weight of 1-Propionyl-eth-lad? |
| A: Molecular weight of 1-Propionyl-eth-lad is 393.5. |
| Q: What is the CAS number of 1-Propionyl-eth-lad? |
| A: CAS number of 1-Propionyl-eth-lad is 2230715-45-2. |