1,1-Cyclobutanedimethanol,1,1-bis(4-methylbenzenesulfonate) structure
|
Common Name | 1,1-Cyclobutanedimethanol,1,1-bis(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 22308-09-4 | Molecular Weight | 424.53100 | |
| Density | 1.289g/cm3 | Boiling Point | 579.5ºC at 760mmHg | |
| Molecular Formula | C20H24O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.3ºC | |
| Name | [1-[(4-methylphenyl)sulfonyloxymethyl]cyclobutyl]methyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 579.5ºC at 760mmHg |
| Molecular Formula | C20H24O6S2 |
| Molecular Weight | 424.53100 |
| Flash Point | 304.3ºC |
| Exact Mass | 424.10100 |
| PSA | 103.50000 |
| LogP | 5.74610 |
| Vapour Pressure | 8.02E-13mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | DBCZPSPFUJJRSK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(COS(=O)(=O)c3ccc(C)cc3)CCC2)cc1 |
|
~87%
1,1-Cyclobutane... CAS#:22308-09-4 |
| Literature: Menger, Fredric M.; Ding, Julia Angewandte Chemie, 1996 , vol. 108, # 18 p. 2266 - 2268 |
|
~%
1,1-Cyclobutane... CAS#:22308-09-4 |
| Literature: Beckwith, Athelstan L. J.; Moad, Graeme Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 1083 - 1092 |
|
~%
1,1-Cyclobutane... CAS#:22308-09-4 |
| Literature: Foos,J. et al. Journal of Organic Chemistry, 1979 , vol. 44, # 14 p. 2522 - 2529 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| bistoluene-p-sulphonate of 1,1-bis(hydroxymethyl)cyclobutane |
| 1,1-bis(O-tosylmethyl)cyclobutane |
| cyclobutane-1,1-diylbis(methylene) bis(4-methylbenzenesulfonate) |
| 1,1-bis<(tosyloxy)methyl>cyclobutane |
| bis(hydroxymethyl)cyclobutane ditosylate |
| 1,1-Bis-(p-toluolsulfonyloxymethyl)-cyclobutan |