4-(2,2-Dicarboethoxy-propyl)phenylacetic Acid structure
|
Common Name | 4-(2,2-Dicarboethoxy-propyl)phenylacetic Acid | ||
|---|---|---|---|---|
| CAS Number | 223123-57-7 | Molecular Weight | 322.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(3-ethoxy-2-ethoxycarbonyl-2-methyl-3-oxopropyl)phenyl]acetic acid |
|---|
| Molecular Formula | C17H22O6 |
|---|---|
| Molecular Weight | 322.35300 |
| Exact Mass | 322.14200 |
| PSA | 89.90000 |
| LogP | 1.98870 |
| InChIKey | XYAHFKQDELAIIC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(Cc1ccc(CC(=O)O)cc1)C(=O)OCC |
|
~67%
4-(2,2-Dicarboe... CAS#:223123-57-7 |
| Literature: Shyadehi, Akbar Z.; Harding, John J. Journal of Labelled Compounds and Radiopharmaceuticals, 1999 , vol. 42, # 3 p. 207 - 213 |