Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride structure
|
Common Name | Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2231663-43-5 | Molecular Weight | 322.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H27ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H27ClN2O4 |
|---|---|
| Molecular Weight | 322.83 |
| InChIKey | KOJPPJSZWXVVTG-QZXXHOLOSA-N |
| SMILES | CCOC(=O)C1CCC(NC(=O)OC(C)(C)C)C(N)C1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride? |
| A: SMILES notation of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride is CCOC(=O)C1CCC(NC(=O)OC(C)(C)C)C(N)C1.Cl. |
| Q: What is the molecular formula of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride? |
| A: Molecular formula of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride is C14H27ClN2O4. |
| Q: What is the InChIKey of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride? |
| A: InChIKey of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride is KOJPPJSZWXVVTG-QZXXHOLOSA-N. |
| Q: What is the Chinese name of 2231663-43-5? |
| A: Chinese name of 2231663-43-5 is 2231663-43-5. |
| Q: What is the CAS number of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride? |
| A: CAS number of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride is 2231663-43-5. |
| Q: What is the English name of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride? |
| A: The English name of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride is Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride. |
| Q: What is the molecular weight of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride? |
| A: Molecular weight of Ethyl (1R,3R,4R)-3-amino-4-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylate hydrochloride is 322.83. |