(1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid
Modify Date: 2026-06-30 23:09:53
(1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid structure
|
Common Name | (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2231663-93-5 | Molecular Weight | 222.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12F2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12F2O4 |
|---|---|
| Molecular Weight | 222.19 |
| InChIKey | SDPFVSZBQQPYAG-WDSKDSINSA-N |
| SMILES | COC(=O)C1CC(F)(F)CCC1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2231663-93-5? |
| A: Chinese name of 2231663-93-5 is 2231663-93-5. |
| Q: What is the molecular weight of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid? |
| A: Molecular weight of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid is 222.19. |
| Q: What is the SMILES notation of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid? |
| A: SMILES notation of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid is COC(=O)C1CC(F)(F)CCC1C(=O)O. |
| Q: What is the molecular formula of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid? |
| A: Molecular formula of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid is C9H12F2O4. |
| Q: What is the English name of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid? |
| A: The English name of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid is (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid. |
| Q: What is the InChIKey of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid? |
| A: InChIKey of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid is SDPFVSZBQQPYAG-WDSKDSINSA-N. |
| Q: What is the CAS number of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid? |
| A: CAS number of (1S,2S)-4,4-difluoro-2-methoxycarbonyl-cyclohexanecarboxylic acid is 2231663-93-5. |