6,7-dimethoxy-2-methyl-1H-benz[de]isoquinoline-1,3(2H)-dione structure
|
Common Name | 6,7-dimethoxy-2-methyl-1H-benz[de]isoquinoline-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 22330-42-3 | Molecular Weight | 271.26800 | |
| Density | 1.325g/cm3 | Boiling Point | 474.2ºC at 760mmHg | |
| Molecular Formula | C15H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.6ºC | |
| Name | 6,7-dimethoxy-2-methylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 474.2ºC at 760mmHg |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.26800 |
| Flash Point | 240.6ºC |
| Exact Mass | 271.08400 |
| PSA | 57.53000 |
| LogP | 1.50690 |
| Vapour Pressure | 3.69E-09mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | GWQIRICPSOISHC-UHFFFAOYSA-N |
| SMILES | COc1ccc2c3c(ccc(OC)c13)C(=O)N(C)C2=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-Dimethoxynaphthalsaeure-N-methylimid |
| EINECS 244-915-5 |