mancozeb
mancozeb structure
|
Common Name | mancozeb | ||
|---|---|---|---|---|
| CAS Number | 2234-56-2 | Molecular Weight | 718.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H27Cl3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | mancozeb |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C41H27Cl3N2O4 |
|---|---|
| Molecular Weight | 718.0 |
| Exact Mass | 716.103640 |
| PSA | 277.68000 |
| LogP | 3.57350 |
| InChIKey | UCTCLHLMQCBHST-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC(=CC=CC4=[N+](C5=C(C=C4)C6=CC=CC=C6C=C5)C7=CC=CC=C7Cl)N3C8=CC=CC=C8Cl.[O-]Cl(=O)(=O)=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2930909055 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2930909055 |
|---|---|
| Summary | 2930909055 zinc(ii) ethane-1,2-diyldicarbamodithioate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of mancozeb? |
| A: InChIKey of mancozeb is UCTCLHLMQCBHST-UHFFFAOYSA-M. |
| Q: What is the molecular weight of mancozeb? |
| A: Molecular weight of mancozeb is 718.0. |
| Q: What is the LogP of mancozeb? |
| A: LogP of mancozeb is 3.57350. |
| Q: What is the polar surface area (PSA) of mancozeb? |
| A: Polar surface area (PSA) of mancozeb is 277.68000. |
| Q: What is the molecular formula of mancozeb? |
| A: Molecular formula of mancozeb is C41H27Cl3N2O4. |
| Q: What is the CAS number of mancozeb? |
| A: CAS number of mancozeb is 2234-56-2. |
| Q: What is the SMILES notation of mancozeb? |
| A: SMILES notation of mancozeb is C1=CC=C2C(=C1)C=CC3=C2C=CC(=CC=CC4=[N+](C5=C(C=C4)C6=CC=CC=C6C=C5)C7=CC=CC=C7Cl)N3C8=CC=CC=C8Cl.[O-]Cl(=O)(=O)=O. |
| Q: What is the English name of mancozeb? |
| A: The English name of mancozeb is mancozeb. |