Vinervine, decarbomethoxy
Modify Date: 2025-11-05 12:03:53
Vinervine, decarbomethoxy structure
|
Common Name | Vinervine, decarbomethoxy | ||
|---|---|---|---|---|
| CAS Number | 22348-46-5 | Molecular Weight | 280.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Vinervine, decarbomethoxy |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20N2O |
|---|---|
| Molecular Weight | 280.4 |
| InChIKey | SOKKYXJWCMASPM-UHFFFAOYSA-N |
| SMILES | CC=C1CN2CCC34C(=CC1CC23)Nc1cc(O)ccc14 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Vinervine, decarbomethoxy? |
| A: Molecular weight of Vinervine, decarbomethoxy is 280.4. |
| Q: What is the CAS number of Vinervine, decarbomethoxy? |
| A: CAS number of Vinervine, decarbomethoxy is 22348-46-5. |
| Q: What is the SMILES notation of Vinervine, decarbomethoxy? |
| A: SMILES notation of Vinervine, decarbomethoxy is CC=C1CN2CCC34C(=CC1CC23)Nc1cc(O)ccc14. |
| Q: What is the Chinese name of 22348-46-5? |
| A: Chinese name of 22348-46-5 is 22348-46-5. |
| Q: What is the molecular formula of Vinervine, decarbomethoxy? |
| A: Molecular formula of Vinervine, decarbomethoxy is C18H20N2O. |
| Q: What is the English name of Vinervine, decarbomethoxy? |
| A: The English name of Vinervine, decarbomethoxy is Vinervine, decarbomethoxy. |
| Q: What is the InChIKey of Vinervine, decarbomethoxy? |
| A: InChIKey of Vinervine, decarbomethoxy is SOKKYXJWCMASPM-UHFFFAOYSA-N. |