7-(4-methoxyphenyl)-6H-1,6-naphthyridin-5-one structure
|
Common Name | 7-(4-methoxyphenyl)-6H-1,6-naphthyridin-5-one | ||
|---|---|---|---|---|
| CAS Number | 223553-68-2 | Molecular Weight | 252.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(4-methoxyphenyl)-6H-1,6-naphthyridin-5-one |
|---|
| Molecular Formula | C15H12N2O2 |
|---|---|
| Molecular Weight | 252.26800 |
| Exact Mass | 252.09000 |
| PSA | 55.24000 |
| LogP | 3.01100 |
| InChIKey | DNWNWDSEKSJBBR-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc3ncccc3c(=O)[nH]2)cc1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibition of human TNKS2 catalytic activity at 10 uM
Source: ChEMBL
Target: Poly [ADP-ribose] polymerase tankyrase-2
External Id: CHEMBL3591894
|
|
Name: Inhibition of human TNKS2 catalytic activity at 1 uM
Source: ChEMBL
Target: Poly [ADP-ribose] polymerase tankyrase-2
External Id: CHEMBL3591895
|
|
Name: Inhibition of human TNKS2 catalytic activity at 100 uM
Source: ChEMBL
Target: Poly [ADP-ribose] polymerase tankyrase-2
External Id: CHEMBL3591893
|