1-[(3-aminopropyl)amino]-4-(methylamino)anthraquinone structure
|
Common Name | 1-[(3-aminopropyl)amino]-4-(methylamino)anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 22366-99-0 | Molecular Weight | 309.36200 | |
| Density | 1.318g/cm3 | Boiling Point | 581.1ºC at 760mmHg | |
| Molecular Formula | C18H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.2ºC | |
| Name | 1-(3-aminopropylamino)-4-(methylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 581.1ºC at 760mmHg |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.36200 |
| Flash Point | 305.2ºC |
| Exact Mass | 309.14800 |
| PSA | 84.22000 |
| LogP | 3.11070 |
| Vapour Pressure | 1.7E-13mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | MLDHMLJPHZYBDV-UHFFFAOYSA-N |
| SMILES | CNc1ccc(NCCCN)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 244-938-0 |
| HC Blue no. 8 |