7-bromo-1,4-dichloroisoquinoline
7-bromo-1,4-dichloroisoquinoline structure
|
Common Name | 7-bromo-1,4-dichloroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 223671-13-4 | Molecular Weight | 276.94500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4BrCl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-bromo-1,4-dichloroisoquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H4BrCl2N |
|---|---|
| Molecular Weight | 276.94500 |
| Exact Mass | 274.89000 |
| PSA | 12.89000 |
| LogP | 4.30410 |
| InChIKey | KWXXBZNOKYQKAI-UHFFFAOYSA-N |
| SMILES | Clc1cnc(Cl)c2cc(Br)ccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
7-bromo-1,4-dic... CAS#:223671-13-4 |
| Literature: Pfizer Inc. Patent: US2003/199440 A1, 2003 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:223671-44-1
CAS#:223671-80-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 7-bromo-1,4-dichloroisoquinoline? |
| A: Polar surface area (PSA) of 7-bromo-1,4-dichloroisoquinoline is 12.89000. |
| Q: What is the molecular weight of 7-bromo-1,4-dichloroisoquinoline? |
| A: Molecular weight of 7-bromo-1,4-dichloroisoquinoline is 276.94500. |
| Q: What is the SMILES notation of 7-bromo-1,4-dichloroisoquinoline? |
| A: SMILES notation of 7-bromo-1,4-dichloroisoquinoline is Clc1cnc(Cl)c2cc(Br)ccc12. |
| Q: What is the InChIKey of 7-bromo-1,4-dichloroisoquinoline? |
| A: InChIKey of 7-bromo-1,4-dichloroisoquinoline is KWXXBZNOKYQKAI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 223671-13-4? |
| A: Chinese name of 223671-13-4 is 223671-13-4. |
| Q: What are the downstream products of 7-bromo-1,4-dichloroisoquinoline? |
| A: Related downstream products(CAS) of 7-bromo-1,4-dichloroisoquinoline: 223671-44-1;223671-80-5. |
| Q: What is the CAS number of 7-bromo-1,4-dichloroisoquinoline? |
| A: CAS number of 7-bromo-1,4-dichloroisoquinoline is 223671-13-4. |
| Q: What is the molecular formula of 7-bromo-1,4-dichloroisoquinoline? |
| A: Molecular formula of 7-bromo-1,4-dichloroisoquinoline is C9H4BrCl2N. |
| Q: What is the English name of 7-bromo-1,4-dichloroisoquinoline? |
| A: The English name of 7-bromo-1,4-dichloroisoquinoline is 7-bromo-1,4-dichloroisoquinoline. |
| Q: What are the upstream materials of 7-bromo-1,4-dichloroisoquinoline? |
| A: Related upstream materials(CAS) of 7-bromo-1,4-dichloroisoquinoline: 5676-63-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |