4-Chloro-1,2-dihydro-1-oxo-7-isoquinolinesulfonyl Chloride structure
|
Common Name | 4-Chloro-1,2-dihydro-1-oxo-7-isoquinolinesulfonyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 223671-81-6 | Molecular Weight | 278.11200 | |
| Density | 1.73g/cm3 | Boiling Point | 519.4ºC at 760 mmHg | |
| Molecular Formula | C9H5Cl2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.9ºC | |
| Name | 4-chloro-1-oxo-2H-isoquinoline-7-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 519.4ºC at 760 mmHg |
| Molecular Formula | C9H5Cl2NO3S |
| Molecular Weight | 278.11200 |
| Flash Point | 267.9ºC |
| Exact Mass | 276.93700 |
| PSA | 75.38000 |
| LogP | 3.18980 |
| Vapour Pressure | 6.87E-11mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | BKJUCAQGGKWKRQ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cc(Cl)c2ccc(S(=O)(=O)Cl)cc12 |
|
~%
4-Chloro-1,2-di... CAS#:223671-81-6 |
| Literature: Fish, Paul V.; Barber, Christopher G.; Brown, David G.; Butt, Richard; Collis, Michael G.; Dickinson, Roger P.; Henry, Brian T.; Horne, Valerie A.; Huggins, John P.; King, Elizabeth; O'Gara, Margaret; McCleverty, Dawn; McIntosh, Fraser; Phillips, Christopher; Webster, Robert Journal of Medicinal Chemistry, 2007 , vol. 50, # 10 p. 2341 - 2351 |
|
~%
4-Chloro-1,2-di... CAS#:223671-81-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 50, # 10 p. 2341 - 2351 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-CHLORO-1-HYDROXY-7-ISOQUINOLINESULFONYL CHLORIDE |
| 4-Chloro-1,2-dihydro-1-oxo-7-isoquinolinesulfonyl Chloride |
| 4-chloro-1-oxo-1,2-dihydro-7-isoquinolinesulphonyl chloride |
| 4-chloro-1-oxo-1,2-dihydro-7-isoquinolinesulfonyl chloride |
| 4-chloro-7-chlorosulphonyl-1-(2H)-isoquinolone |