dibromo-(2-dibromoboranyl-3,4,5,6-tetrafluorophenyl)borane structure
|
Common Name | dibromo-(2-dibromoboranyl-3,4,5,6-tetrafluorophenyl)borane | ||
|---|---|---|---|---|
| CAS Number | 223769-11-7 | Molecular Weight | 489.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6B2Br4F4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dibromo-(2-dibromoboranyl-3,4,5,6-tetrafluorophenyl)borane |
|---|
| Molecular Formula | C6B2Br4F4 |
|---|---|
| Molecular Weight | 489.29600 |
| Exact Mass | 485.68600 |
| LogP | 3.21300 |
| InChIKey | BVTPZEHJFJNPDS-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(B(Br)Br)c(B(Br)Br)c1F |
|
~81%
dibromo-(2-dibr... CAS#:223769-11-7 |
| Literature: Williams, V. Clifford; Piers, Warren E.; Clegg, William; Elsegood, Mark R.J.; Collins, Scott; Mardell, Todd B. Journal of the American Chemical Society, 1999 , vol. 121, # 13 p. 3244 - 3245 |