Serratenediol structure
|
Common Name | Serratenediol | ||
|---|---|---|---|---|
| CAS Number | 2239-24-9 | Molecular Weight | 442.717 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 530.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3±24.7 °C | |
Use of SerratenediolSerratenediol (Cathaya D) is a triterpenoid isolated from Pinus banksiana Lamb[1]. |
| Name | Serratenediol |
|---|---|
| Synonym | More Synonyms |
| Description | Serratenediol (Cathaya D) is a triterpenoid isolated from Pinus banksiana Lamb[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 530.9±50.0 °C at 760 mmHg |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.717 |
| Flash Point | 215.3±24.7 °C |
| Exact Mass | 442.381073 |
| PSA | 40.46000 |
| LogP | 9.10 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | FMUNNDDBCLRMSL-PIGMOXAFSA-N |
| SMILES | CC12CCC3C(C)(C)C(O)CCC3(C)C1CCC1C(=CCC3C(C)(C)C(O)CCC13C)C2 |
|
Name: Inhibition of Candida albicans secreted aspartic protease
Source: ChEMBL
Target: N/A
External Id: CHEMBL1008082
|
| serratenediol |
| (3S,4aR,6aS,9aR,11S,13aR,13bS,15aS,15bR)-4,4,6a,10,10,13a,15b-Heptamethyl-2,3,4,4a,5,6,6a,7,9,9a,10,11,12,13,13a,13b,14,15,15a,15b-icosahydro-1H-naphtho[2',1':4,5]cyclohepta[1,2-a]naphthalene-3,11-diol |