8-NITRO-2,3,4,5-TETRAHYDRO-1H-BENZO[C]AZEPINE structure
|
Common Name | 8-NITRO-2,3,4,5-TETRAHYDRO-1H-BENZO[C]AZEPINE | ||
|---|---|---|---|---|
| CAS Number | 223915-75-1 | Molecular Weight | 192.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Nitro-2,3,4,5-tetrahydro-1H-2-benzazepine |
|---|
| Molecular Formula | C10H12N2O2 |
|---|---|
| Molecular Weight | 192.21400 |
| Exact Mass | 192.09000 |
| PSA | 57.85000 |
| LogP | 2.48260 |
| InChIKey | SMAZDNVHMACXLU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CNCCC2 |
| HS Code | 2933990090 |
|---|
|
~85%
8-NITRO-2,3,4,5... CAS#:223915-75-1 |
| Literature: ASTRAZENECA AB Patent: WO2007/4959 A1, 2007 ; Location in patent: Page/Page column 50 ; WO 2007/004959 A1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibitory activity against bovine adrenal phenylethanolamine N-methyl-transferase (P...
Source: ChEMBL
Target: Phenylethanolamine N-methyltransferase
External Id: CHEMBL760054
|
|
Name: Inhibition of [3H]clonidine binding to the rat alpha-2-adrenoceptor
Source: ChEMBL
Target: Alpha-2A adrenergic receptor
External Id: CHEMBL641405
|