3-[N-(p-Fluorophenyl)formimidoyl]-1H-indole structure
|
Common Name | 3-[N-(p-Fluorophenyl)formimidoyl]-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 22394-32-7 | Molecular Weight | 238.26000 | |
| Density | 1.18g/cm3 | Boiling Point | 394.1ºC at 760mmHg | |
| Molecular Formula | C15H11FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | 4-fluoro-N-[(Z)-indol-3-ylidenemethyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 394.1ºC at 760mmHg |
| Molecular Formula | C15H11FN2 |
| Molecular Weight | 238.26000 |
| Flash Point | 192.2ºC |
| Exact Mass | 238.09100 |
| PSA | 24.39000 |
| LogP | 3.50320 |
| Vapour Pressure | 2.02E-06mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | QCFXPMWONHBKIA-UHFFFAOYSA-N |
| SMILES | Fc1ccc(N=Cc2c[nH]c3ccccc23)cc1 |
|
~77%
3-[N-(p-Fluorop... CAS#:22394-32-7 |
| Literature: Kaur, Jatinder; Bhardwaj, Atul; Huang, Zhangjian; Knaus, Edward E. Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 6 p. 2154 - 2159 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-fluoro-N-indol-3-ylmethylene-aniline |