Benzene,1-[2-(4-methoxyphenyl)ethenyl]-2,4-dinitro- structure
|
Common Name | Benzene,1-[2-(4-methoxyphenyl)ethenyl]-2,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 22396-03-8 | Molecular Weight | 300.26600 | |
| Density | 1.362g/cm3 | Boiling Point | 450.4ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 1-[(E)-2-(4-methoxyphenyl)ethenyl]-2,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 450.4ºC at 760 mmHg |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.26600 |
| Flash Point | 193.1ºC |
| Exact Mass | 300.07500 |
| PSA | 100.87000 |
| LogP | 4.72840 |
| Vapour Pressure | 7.03E-08mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | ZZFDGUCCHZJOQB-GORDUTHDSA-N |
| SMILES | COc1ccc(C=Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2'.4'-Dinitro-4-methoxy-stilben |
| Anisole,4-dinitrostyryl) |
| T0512-4748 |