3H-Indolium,2-[2-(8-hydroxy-5-quinolinyl)ethenyl]-1,3,3-trimethyl-, chloride (1:1)
![3H-Indolium,2-[2-(8-hydroxy-5-quinolinyl)ethenyl]-1,3,3-trimethyl-, chloride (1:1) Structure](https://image.chemsrc.com/caspic/323/2240-70-2.png)
3H-Indolium,2-[2-(8-hydroxy-5-quinolinyl)ethenyl]-1,3,3-trimethyl-, chloride (1:1) structure
|
Common Name | 3H-Indolium,2-[2-(8-hydroxy-5-quinolinyl)ethenyl]-1,3,3-trimethyl-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 2240-70-2 | Molecular Weight | 329.41500 | |
| Density | N/A | Boiling Point | 502ºC at 760mmHg | |
| Molecular Formula | C22H21N2O+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 502ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H21N2O+ |
| Molecular Weight | 329.41500 |
| Flash Point | 257.4ºC |
| Exact Mass | 329.16500 |
| PSA | 36.13000 |
| LogP | 4.61860 |
| Vapour Pressure | 3.31E-10mmHg at 25°C |
| InChIKey | BDAKSAPSXVGUJW-UHFFFAOYSA-O |
| SMILES | C[N+]1=C(C=Cc2ccc(O)c3ncccc23)C(C)(C)c2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3H-Indolium,2-[... CAS#:2240-70-2 |
| Literature: Faller et al. Journal of Organic Chemistry, 1964 , vol. 29, p. 3450,3451 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: Polar surface area (PSA) of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one is 36.13000. |
| Q: What are the upstream materials of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: Related upstream materials(CAS) of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one: 2598-30-3;5418-63-3. |
| Q: What is the molecular formula of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: Molecular formula of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one is C22H21N2O+. |
| Q: What is the SMILES notation of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: SMILES notation of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one is C[N+]1=C(C=Cc2ccc(O)c3ncccc23)C(C)(C)c2ccccc21. |
| Q: What is the Chinese name of 2240-70-2? |
| A: Chinese name of 2240-70-2 is 2240-70-2. |
| Q: What is the molecular weight of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: Molecular weight of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one is 329.41500. |
| Q: What is the InChIKey of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: InChIKey of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one is BDAKSAPSXVGUJW-UHFFFAOYSA-O. |
| Q: What is the CAS number of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: CAS number of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one is 2240-70-2. |
| Q: What is the LogP of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: LogP of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one is 4.61860. |
| Q: What is the English name of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one? |
| A: The English name of (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one is (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |