3H-Indolium,2-[2-(8-hydroxy-5-quinolinyl)ethenyl]-1,3,3-trimethyl-, chloride (1:1)
Modify Date: 2025-09-12 08:46:03
![3H-Indolium,2-[2-(8-hydroxy-5-quinolinyl)ethenyl]-1,3,3-trimethyl-, chloride (1:1) Structure](https://image.chemsrc.com/caspic/323/2240-70-2.png)
3H-Indolium,2-[2-(8-hydroxy-5-quinolinyl)ethenyl]-1,3,3-trimethyl-, chloride (1:1) structure
|
Common Name | 3H-Indolium,2-[2-(8-hydroxy-5-quinolinyl)ethenyl]-1,3,3-trimethyl-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 2240-70-2 | Molecular Weight | 329.41500 | |
| Density | N/A | Boiling Point | 502ºC at 760mmHg | |
| Molecular Formula | C22H21N2O+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.4ºC | |
| Name | (5Z)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]quinolin-1-ium-8-one |
|---|
| Boiling Point | 502ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H21N2O+ |
| Molecular Weight | 329.41500 |
| Flash Point | 257.4ºC |
| Exact Mass | 329.16500 |
| PSA | 36.13000 |
| LogP | 4.61860 |
| Vapour Pressure | 3.31E-10mmHg at 25°C |
| InChIKey | BDAKSAPSXVGUJW-UHFFFAOYSA-O |
| SMILES | C[N+]1=C(C=Cc2ccc(O)c3ncccc23)C(C)(C)c2ccccc21 |
|
~%
3H-Indolium,2-[... CAS#:2240-70-2 |
| Literature: Faller et al. Journal of Organic Chemistry, 1964 , vol. 29, p. 3450,3451 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1