Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine
Modify Date: 2025-09-10 13:07:06
![Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine Structure](https://www.chemsrc.com/extcaspic/178/2244143-09-5.png)
Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine structure
|
Common Name | Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine | ||
|---|---|---|---|---|
| CAS Number | 2244143-09-5 | Molecular Weight | 395.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H22NO2PS |
|---|---|
| Molecular Weight | 395.5 |
| InChIKey | SJQXCVUHXMHJMD-ZVOVDXHFSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3CC2CP3c2ccc3ccccc3c2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: CAS number of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine is 2244143-09-5. |
| Q: What is the English name of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: The English name of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine is Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine. |
| Q: What is the InChIKey of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: InChIKey of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine is SJQXCVUHXMHJMD-ZVOVDXHFSA-N. |
| Q: What is the SMILES notation of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: SMILES notation of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine is Cc1ccc(S(=O)(=O)N2CC3CC2CP3c2ccc3ccccc3c2)cc1. |
| Q: What is the molecular weight of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: Molecular weight of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine is 395.5. |
| Q: What is the molecular formula of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: Molecular formula of Exo-2-Naphthyl Kwon [2.2.1] Bicyclic Phosphine is C22H22NO2PS. |
| Q: What is the Chinese name of 2244143-09-5? |
| A: Chinese name of 2244143-09-5 is 2244143-09-5. |