Methyl 3,5-diformyl-2-naphthoate
Modify Date: 2025-10-11 10:53:35
Methyl 3,5-diformyl-2-naphthoate structure
|
Common Name | Methyl 3,5-diformyl-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 224445-89-0 | Molecular Weight | 242.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3,5-diformyl-2-naphthoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10O4 |
|---|---|
| Molecular Weight | 242.23 |
| InChIKey | RHZNFCLAKBTWDO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cccc(C=O)c2cc1C=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 224445-89-0? |
| A: Chinese name of 224445-89-0 is 224445-89-0. |
| Q: What is the InChIKey of Methyl 3,5-diformyl-2-naphthoate? |
| A: InChIKey of Methyl 3,5-diformyl-2-naphthoate is RHZNFCLAKBTWDO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methyl 3,5-diformyl-2-naphthoate? |
| A: Molecular weight of Methyl 3,5-diformyl-2-naphthoate is 242.23. |
| Q: What is the English name of Methyl 3,5-diformyl-2-naphthoate? |
| A: The English name of Methyl 3,5-diformyl-2-naphthoate is Methyl 3,5-diformyl-2-naphthoate. |
| Q: What is the molecular formula of Methyl 3,5-diformyl-2-naphthoate? |
| A: Molecular formula of Methyl 3,5-diformyl-2-naphthoate is C14H10O4. |
| Q: What is the CAS number of Methyl 3,5-diformyl-2-naphthoate? |
| A: CAS number of Methyl 3,5-diformyl-2-naphthoate is 224445-89-0. |
| Q: What is the SMILES notation of Methyl 3,5-diformyl-2-naphthoate? |
| A: SMILES notation of Methyl 3,5-diformyl-2-naphthoate is COC(=O)c1cc2cccc(C=O)c2cc1C=O. |