Benzoic acid,2-[(2-chlorophenyl)methylene]hydrazide structure
|
Common Name | Benzoic acid,2-[(2-chlorophenyl)methylene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 22454-53-1 | Molecular Weight | 258.70300 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phenol,2-chloro-5-methyl-,benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.70300 |
| Exact Mass | 258.05600 |
| PSA | 41.46000 |
| LogP | 3.49480 |
| Index of Refraction | 1.592 |
| InChIKey | DNLLPFIDUQYSRL-UHFFFAOYSA-N |
| SMILES | O=C(NN=Cc1ccccc1Cl)c1ccccc1 |
| HS Code | 2928000090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Benzoesaeure-(2-chlor-benzylidenhydrazid) |
| 3-benzoyloxy-4-chlorotoluene |
| benzoic acid-(2-chloro-benzylidenehydrazide) |
| N'-(2-chlorobenzylidene)benzohydrazide |
| 4-Chlor-3-benzoyloxy-toluol |
| benzoic acid-(2-chloro-5-methyl-phenyl ester) |
| (6-Chlor-3-methyl-phenyl)-benzoat |
| 2-Chlor-benzaldehyd-(benzoylhydrazon) |
| Benzoesaeure-(2-chlor-5-methyl-phenylester) |