1,4-dibromo-2-(2-ethylhexoxy)-5-methoxybenzene structure
|
Common Name | 1,4-dibromo-2-(2-ethylhexoxy)-5-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 224558-17-2 | Molecular Weight | 394.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-dibromo-2-(2-ethylhexoxy)-5-methoxybenzene |
|---|
| Molecular Formula | C15H22Br2O2 |
|---|---|
| Molecular Weight | 394.14200 |
| Exact Mass | 391.99900 |
| PSA | 18.46000 |
| LogP | 5.81540 |
| InChIKey | HHMXNTWGFMVVSV-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COc1cc(Br)c(OC)cc1Br |
|
~%
1,4-dibromo-2-(... CAS#:224558-17-2 |
| Literature: Kim, Yun-Hi; Jung, Sang-Yun; Kwon, Soon-Ki Molecular Crystals and Liquid Crystals, 2006 , vol. 444, p. 169 - 176 |
|
~%
1,4-dibromo-2-(... CAS#:224558-17-2 |
| Literature: Kim, Yun-Hi; Jung, Sang-Yun; Kwon, Soon-Ki Molecular Crystals and Liquid Crystals, 2006 , vol. 444, p. 169 - 176 |
|
~%
1,4-dibromo-2-(... CAS#:224558-17-2 |
| Literature: Kim, Yun-Hi; Jung, Sang-Yun; Kwon, Soon-Ki Molecular Crystals and Liquid Crystals, 2006 , vol. 444, p. 169 - 176 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |