CPHPC structure
|
Common Name | CPHPC | ||
|---|---|---|---|---|
| CAS Number | 224624-80-0 | Molecular Weight | 340.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CPHPCMiridesap is a ligand for serum amyloid P component (SAP) and intends to inhibit and dissociate SAP binding to amyloid fibrils and tangles. |
| Name | (2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Miridesap is a ligand for serum amyloid P component (SAP) and intends to inhibit and dissociate SAP binding to amyloid fibrils and tangles. |
|---|---|
| Related Catalog | |
| Target |
SAP[1] |
| In Vitro | Miridesap is a ligand for serum amyloid P component (SAP) and intends to inhibit and dissociate SAP binding to amyloid fibrils and tangles[1]. Miridesap depletes circulating SAP almost completely but leaves some SAP in amyloid deposits for specific recognition by subsequently administered therapeutic anti-SAP antibodies[2]. |
| References |
| Molecular Formula | C16H24N2O6 |
|---|---|
| Molecular Weight | 340.37200 |
| Exact Mass | 340.16300 |
| PSA | 115.22000 |
| LogP | 0.57380 |
| Vapour Pressure | 1.13E-19mmHg at 25°C |
| InChIKey | HZLAWYIBLZNRFZ-VXGBXAGGSA-N |
| SMILES | O=C(O)C1CCCN1C(=O)CCCCC(=O)N1CCCC1C(=O)O |
| Storage condition | 2-8℃ |
| GHE |
| CPOHPC acid |
| cphpc |
| Ro 63-8695 |
| (2r)-1-[6-[(2r)-2-Carboxypyrrolidin-1-Yl]-6-Oxidanylidene-Hexanoyl]pyrrolidine-2-Carboxylic Acid |
| Miridesap |