Acetamide,N-[1,1-bis(4-chlorophenyl)-2,2,2-trifluoroethyl]- structure
|
Common Name | Acetamide,N-[1,1-bis(4-chlorophenyl)-2,2,2-trifluoroethyl]- | ||
|---|---|---|---|---|
| CAS Number | 2247-71-4 | Molecular Weight | 362.17400 | |
| Density | 1.364g/cm3 | Boiling Point | 458.6ºC at 760 mmHg | |
| Molecular Formula | C16H12Cl2F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.2ºC | |
| Name | N-[1,1-bis(4-chlorophenyl)-2,2,2-trifluoroethyl]acetamide |
|---|
| Density | 1.364g/cm3 |
|---|---|
| Boiling Point | 458.6ºC at 760 mmHg |
| Molecular Formula | C16H12Cl2F3NO |
| Molecular Weight | 362.17400 |
| Flash Point | 231.2ºC |
| Exact Mass | 361.02500 |
| PSA | 29.10000 |
| LogP | 5.32630 |
| Vapour Pressure | 1.35E-08mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | NPRLBMKFRSLGSQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(F)(F)F |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |