trimethyl-(3-trimethylsilylbuta-1,3-dien-2-yl)silane structure
|
Common Name | trimethyl-(3-trimethylsilylbuta-1,3-dien-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 22472-36-2 | Molecular Weight | 198.45300 | |
| Density | 0.778g/cm3 | Boiling Point | 185.1ºC at 760 mmHg | |
| Molecular Formula | C10H22Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 47.2ºC | |
| Name | trimethyl(3-trimethylsilylbuta-1,3-dien-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.778g/cm3 |
|---|---|
| Boiling Point | 185.1ºC at 760 mmHg |
| Molecular Formula | C10H22Si2 |
| Molecular Weight | 198.45300 |
| Flash Point | 47.2ºC |
| Exact Mass | 198.12600 |
| LogP | 3.85360 |
| Vapour Pressure | 0.971mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | RJSCYACDEKOHFB-UHFFFAOYSA-N |
| SMILES | C=C(C(=C)[Si](C)(C)C)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,5-Disilahexane,2,2,5,5-tetramethyl-3,4-dimethylene |