(2-Methyl-5-nitrophenyl)methanol structure
|
Common Name | (2-Methyl-5-nitrophenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 22474-47-1 | Molecular Weight | 167.16200 | |
| Density | 1.272g/cm3 | Boiling Point | 342.1ºC at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.9ºC | |
| Name | (2-Methyl-5-nitrophenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 342.1ºC at 760 mmHg |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16200 |
| Flash Point | 154.9ºC |
| Exact Mass | 167.05800 |
| PSA | 66.05000 |
| LogP | 1.91870 |
| Vapour Pressure | 2.96E-05mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | IBQRNQSJJZLSTK-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1CO |
| HS Code | 2906299090 |
|---|
|
~94%
(2-Methyl-5-nit... CAS#:22474-47-1 |
| Literature: US2002/61872 A1, ; |
|
~%
(2-Methyl-5-nit... CAS#:22474-47-1 |
| Literature: Journal of the American Chemical Society, , vol. 136, # 9 p. 3673 - 3679 |
|
~%
(2-Methyl-5-nit... CAS#:22474-47-1 |
| Literature: Die Pharmazie, , vol. 24, # 2 p. 87 - 94 |
|
~%
(2-Methyl-5-nit... CAS#:22474-47-1 |
| Literature: Journal of Organic Chemistry, , vol. 22, p. 1043 US2373438 , ; |
|
~%
(2-Methyl-5-nit... CAS#:22474-47-1 |
| Literature: Journal of Organic Chemistry, , vol. 22, p. 1043 |
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Benzenemethanol,2-methyl-5-nitro |
| 5-Nitro-2-methyl-1-hydroxymethyl-benzol |
| 2-Methyl-5-nitro-benzylalkohol |
| 2-methyl-5-nitro-benzyl alcohol |
| BEN302 |
| 3-HYDROXYMETHYL-4-METHYL-NITROBENZENE |