1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate
Modify Date: 2026-07-03 15:11:10
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate structure
|
Common Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248279-27-6 | Molecular Weight | 287.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9N3O5 |
|---|---|
| Molecular Weight | 287.23 |
| InChIKey | VVFWELPYPRDPKD-UHFFFAOYSA-N |
| SMILES | Cn1[nH]c(C(=O)ON2C(=O)c3ccccc3C2=O)cc1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: Molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is 287.23. |
| Q: What is the Chinese name of 2248279-27-6? |
| A: Chinese name of 2248279-27-6 is 2248279-27-6. |
| Q: What is the SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is Cn1[nH]c(C(=O)ON2C(=O)c3ccccc3C2=O)cc1=O. |
| Q: What is the molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: Molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is C13H9N3O5. |
| Q: What is the InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is VVFWELPYPRDPKD-UHFFFAOYSA-N. |
| Q: What is the English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: The English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate. |
| Q: What is the CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is 2248279-27-6. |