1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate structure
|
Common Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248291-89-4 | Molecular Weight | 342.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14N2O6 |
|---|---|
| Molecular Weight | 342.30 |
| InChIKey | WINPACAYAQGLNG-UHFFFAOYSA-N |
| SMILES | O=C(ON1C(=O)c2ccccc2C1=O)c1coc(C2CCOCC2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate? |
| A: InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate is WINPACAYAQGLNG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate? |
| A: Molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate is C17H14N2O6. |
| Q: What is the Chinese name of 2248291-89-4? |
| A: Chinese name of 2248291-89-4 is 2248291-89-4. |
| Q: What is the English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate? |
| A: The English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate is 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate. |
| Q: What is the SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate? |
| A: SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate is O=C(ON1C(=O)c2ccccc2C1=O)c1coc(C2CCOCC2)n1. |
| Q: What is the molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate? |
| A: Molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate is 342.30. |
| Q: What is the CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate? |
| A: CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(oxan-4-yl)-1,3-oxazole-4-carboxylate is 2248291-89-4. |