1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate
Modify Date: 2025-11-04 15:46:21
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate structure
|
Common Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248317-12-4 | Molecular Weight | 352.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H9FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H9FN2O5 |
|---|---|
| Molecular Weight | 352.3 |
| InChIKey | AHYRRSBIHPBPCV-UHFFFAOYSA-N |
| SMILES | O=C(ON1C(=O)c2ccccc2C1=O)c1cc(-c2ccccc2F)no1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate? |
| A: The English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate is 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate. |
| Q: What is the molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate? |
| A: Molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate is C18H9FN2O5. |
| Q: What is the SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate? |
| A: SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate is O=C(ON1C(=O)c2ccccc2C1=O)c1cc(-c2ccccc2F)no1. |
| Q: What is the molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate? |
| A: Molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate is 352.3. |
| Q: What is the CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate? |
| A: CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate is 2248317-12-4. |
| Q: What is the InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate? |
| A: InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(2-fluorophenyl)-1,2-oxazole-5-carboxylate is AHYRRSBIHPBPCV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2248317-12-4? |
| A: Chinese name of 2248317-12-4 is 2248317-12-4. |