6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate
Modify Date: 2026-07-23 10:58:16
![6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate Structure](https://www.chemsrc.com/extcaspic/226/2248317-17-9.png)
6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate structure
|
Common Name | 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248317-17-9 | Molecular Weight | 400.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24N2O6 |
|---|---|
| Molecular Weight | 400.4 |
| InChIKey | NOYSGCXIKHPFTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC2C(=O)ON1C(=O)c2ccccc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate? |
| A: Molecular formula of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate is C21H24N2O6. |
| Q: What is the English name of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate? |
| A: The English name of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate is 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate. |
| Q: What is the CAS number of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate? |
| A: CAS number of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate is 2248317-17-9. |
| Q: What is the Chinese name of 2248317-17-9? |
| A: Chinese name of 2248317-17-9 is 2248317-17-9. |
| Q: What is the molecular weight of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate? |
| A: Molecular weight of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate is 400.4. |
| Q: What is the InChIKey of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate? |
| A: InChIKey of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate is NOYSGCXIKHPFTF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate? |
| A: SMILES notation of 6-tert-butyl 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 6-azaspiro[2.5]octane-1,6-dicarboxylate is CC(C)(C)OC(=O)N1CCC2(CC1)CC2C(=O)ON1C(=O)c2ccccc2C1=O. |